C14H18BrNO3S — CID 65014642
2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 65014642) has the molecular formula C14H18BrNO3S and a molecular weight of 360.27 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 65014642 |
| Molecular Formula | C14H18BrNO3S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 359.02 |
| IUPAC Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CC(C)(C)C(CBr)CN1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C14H18BrNO3S/c1-14(2,3)10(8-15)9-16-13(17)11-6-4-5-7-12(11)20(16,18)19/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | PHPIVICGDSIEED-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|