C15H18BrNO2 — CID 65014935
2-[2-(bromomethyl)-3,3-dimethylbutyl]isoindole-1,3-dione (PubChem CID 65014935) has the molecular formula C15H18BrNO2 and a molecular weight of 324.22 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3,3-dimethylbutyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 65014935 |
| Molecular Formula | C15H18BrNO2 |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]isoindole-1,3-dione |
| SMILES | CC(C)(C)C(CBr)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H18BrNO2/c1-15(2,3)10(8-16)9-17-13(18)11-6-4-5-7-12(11)14(17)19/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | YTGOFBQSRHVLMS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|