C16H22BrNO2 — CID 65014349
4-[2-(bromomethyl)-3,3-dimethylbutyl]-2-methyl-1,4-benzoxazin-3-one (PubChem CID 65014349) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2-methyl-1,4-benzoxazin-3-one.
| Compound Name | 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2-methyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 65014349 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 4-[2-(bromomethyl)-3,3-dimethylbutyl]-2-methyl-1,4-benzoxazin-3-one |
| SMILES | CC1Oc2ccccc2N(CC(CBr)C(C)(C)C)C1=O |
| InChI | InChI=1S/C16H22BrNO2/c1-11-15(19)18(10-12(9-17)16(2,3)4)13-7-5-6-8-14(13)20-11/h5-8,11-12H,9-10H2,1-4H3 |
| InChIKey | VKPUNMBWBKETPA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|