C15H22BrN — CID 65015648
2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,3-dihydroisoindole (PubChem CID 65015648) has the molecular formula C15H22BrN and a molecular weight of 296.25 g/mol. Its IUPAC name is 2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,3-dihydroisoindole.
| Compound Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 65015648 |
| Molecular Formula | C15H22BrN |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[2-(bromomethyl)-3,3-dimethylbutyl]-1,3-dihydroisoindole |
| SMILES | CC(C)(C)C(CBr)CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C15H22BrN/c1-15(2,3)14(8-16)11-17-9-12-6-4-5-7-13(12)10-17/h4-7,14H,8-11H2,1-3H3 |
| InChIKey | DIDITVBMNZNCAQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|