C12H17NO2 — CID 66223848
2-(2,2-dimethoxyethyl)-1,3-dihydroisoindole (PubChem CID 66223848) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethyl)-1,3-dihydroisoindole.
| Compound Name | 2-(2,2-dimethoxyethyl)-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 66223848 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-(2,2-dimethoxyethyl)-1,3-dihydroisoindole |
| SMILES | COC(CN1Cc2ccccc2C1)OC |
| InChI | InChI=1S/C12H17NO2/c1-14-12(15-2)9-13-7-10-5-3-4-6-11(10)8-13/h3-6,12H,7-9H2,1-2H3 |
| InChIKey | QWDQPGAHCGVYDZ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|