C18H22N6O3S — CID 19023449
5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one (PubChem CID 19023449) has the molecular formula C18H22N6O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one.
| Compound Name | 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 19023449 |
| Molecular Formula | C18H22N6O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one |
| SMILES | Nc1ccc2c(c1)C(=O)N(CCCN1CCN(c3ncccn3)CC1)S2(=O)=O |
| InChI | InChI=1S/C18H22N6O3S/c19-14-3-4-16-15(13-14)17(25)24(28(16,26)27)8-2-7-22-9-11-23(12-10-22)18-20-5-1-6-21-18/h1,3-6,13H,2,7-12,19H2 |
| InChIKey | SURXYKBSZYACJN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|