About 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one
5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one (PubChem CID 19023449) has the molecular formula C18H22N6O3S
and a molecular weight of 402.48 g/mol. Its IUPAC name is 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one |
| PubChem CID | 19023449 |
| Molecular Formula | C18H22N6O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one |
| SMILES | Nc1ccc2c(c1)C(=O)N(CCCN1CCN(c3ncccn3)CC1)S2(=O)=O |
| InChI | InChI=1S/C18H22N6O3S/c19-14-3-4-16-15(13-14)17(25)24(28(16,26)27)8-2-7-22-9-11-23(12-10-22)18-20-5-1-6-21-18/h1,3-6,13H,2,7-12,19H2 |
| InChIKey | SURXYKBSZYACJN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one?
The IUPAC name of 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one (CID 19023449) is 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one.
What is the SMILES notation for 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one?
The canonical SMILES for 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one is Nc1ccc2c(c1)C(=O)N(CCCN1CCN(c3ncccn3)CC1)S2(=O)=O.
What is the InChIKey of 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one?
The InChIKey is SURXYKBSZYACJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N6O3S/c19-14-3-4-16-15(13-14)17(25)24(28(16,26)27)8-2-7-22-9-11-23(12-10-22)18-20-5-1-6-21-18/h1,3-6,13H,2,7-12,19H2.
What are the key properties of 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one?
5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one has a molecular weight of 402.48 g/mol, XLogP of 0.42, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,1-dioxo-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1,2-benzothiazol-3-one is sourced from PubChem (CID 19023449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).