C19H23ClN6O3S — CID 19023460
7-chloro-1,1-dioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-4H-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 19023460) has the molecular formula C19H23ClN6O3S and a molecular weight of 450.95 g/mol. Its IUPAC name is 7-chloro-1,1-dioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-4H-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 7-chloro-1,1-dioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-4H-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 19023460 |
| Molecular Formula | C19H23ClN6O3S |
| Molecular Weight | 450.95 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 7-chloro-1,1-dioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-4H-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | O=C1Nc2ccc(Cl)cc2S(=O)(=O)N1CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C19H23ClN6O3S/c20-15-4-5-16-17(14-15)30(28,29)26(19(27)23-16)9-2-1-8-24-10-12-25(13-11-24)18-21-6-3-7-22-18/h3-7,14H,1-2,8-13H2,(H,23,27) |
| InChIKey | FTOZHGJYEPCVCD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.95 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|