C20H26N6O5S2 — CID 67842578
N-[1,1,3-trioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-6-yl]methanesulfonamide (PubChem CID 67842578) has the molecular formula C20H26N6O5S2 and a molecular weight of 494.60 g/mol. Its IUPAC name is N-[1,1,3-trioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-6-yl]methanesulfonamide.
| Compound Name | N-[1,1,3-trioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 67842578 |
| Molecular Formula | C20H26N6O5S2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-[1,1,3-trioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-6-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc2c(c1)S(=O)(=O)N(CCCCN1CCN(c3ncccn3)CC1)C2=O |
| InChI | InChI=1S/C20H26N6O5S2/c1-32(28,29)23-16-5-6-17-18(15-16)33(30,31)26(19(17)27)10-3-2-9-24-11-13-25(14-12-24)20-21-7-4-8-22-20/h4-8,15,23H,2-3,9-14H2,1H3 |
| InChIKey | NOZAZEIPQCFTBY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|