C21H28N6O5S3 — CID 56612445
N-methylsulfonyl-N-[3-oxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-6-yl]methanesulfonamide (PubChem CID 56612445) has the molecular formula C21H28N6O5S3 and a molecular weight of 540.69 g/mol. Its IUPAC name is N-methylsulfonyl-N-[3-oxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-6-yl]methanesulfonamide.
| Compound Name | N-methylsulfonyl-N-[3-oxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-6-yl]methanesulfonamide |
|---|---|
| PubChem CID | 56612445 |
| Molecular Formula | C21H28N6O5S3 |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | N-methylsulfonyl-N-[3-oxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-6-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(c1ccc2c(=O)n(CCCCN3CCN(c4ncccn4)CC3)sc2c1)S(C)(=O)=O |
| InChI | InChI=1S/C21H28N6O5S3/c1-34(29,30)27(35(2,31)32)17-6-7-18-19(16-17)33-26(20(18)28)11-4-3-10-24-12-14-25(15-13-24)21-22-8-5-9-23-21/h5-9,16H,3-4,10-15H2,1-2H3 |
| InChIKey | KPIAYBBTRWQUHR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 125.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|