C17H29N5O — CID 14622622
N,2-dimethyl-N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]propanamide (PubChem CID 14622622) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is N,2-dimethyl-N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]propanamide.
| Compound Name | N,2-dimethyl-N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]propanamide |
|---|---|
| PubChem CID | 14622622 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | N,2-dimethyl-N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]propanamide |
| SMILES | CC(C)C(=O)N(C)CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H29N5O/c1-15(2)16(23)20(3)9-4-5-10-21-11-13-22(14-12-21)17-18-7-6-8-19-17/h6-8,15H,4-5,9-14H2,1-3H3 |
| InChIKey | GDZWVHGALGVFQW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|