C16H28N6O — CID 119902328
(2S)-2-amino-4-methyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]pentanamide (PubChem CID 119902328) has the molecular formula C16H28N6O and a molecular weight of 320.44 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 119902328 |
| Molecular Formula | C16H28N6O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]pentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)NCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H28N6O/c1-13(2)12-14(17)15(23)18-6-7-21-8-10-22(11-9-21)16-19-4-3-5-20-16/h3-5,13-14H,6-12,17H2,1-2H3,(H,18,23)/t14-/m0/s1 |
| InChIKey | HLRXYWMVLPYLCL-AWEZNQCLSA-N |
| XLogP | 0.09 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |