C18H31N5O — CID 14622624
N,3-dimethyl-N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]butanamide (PubChem CID 14622624) has the molecular formula C18H31N5O and a molecular weight of 333.48 g/mol. Its IUPAC name is N,3-dimethyl-N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]butanamide.
| Compound Name | N,3-dimethyl-N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]butanamide |
|---|---|
| PubChem CID | 14622624 |
| Molecular Formula | C18H31N5O |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | N,3-dimethyl-N-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]butanamide |
| SMILES | CC(C)CC(=O)N(C)CCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H31N5O/c1-16(2)15-17(24)21(3)9-4-5-10-22-11-13-23(14-12-22)18-19-7-6-8-20-18/h6-8,16H,4-5,9-15H2,1-3H3 |
| InChIKey | IBTAWLQBHIFSSV-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|