C19H35N7 — CID 111159043
1-butyl-3-ethyl-1-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111159043) has the molecular formula C19H35N7 and a molecular weight of 361.54 g/mol. Its IUPAC name is 1-butyl-3-ethyl-1-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-butyl-3-ethyl-1-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111159043 |
| Molecular Formula | C19H35N7 |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.30 |
| IUPAC Name | 1-butyl-3-ethyl-1-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCCCN(C)/C(=N/CCCN1CCN(c2ncccn2)CC1)NCC |
| InChI | InChI=1S/C19H35N7/c1-4-6-12-24(3)18(20-5-2)21-11-8-13-25-14-16-26(17-15-25)19-22-9-7-10-23-19/h7,9-10H,4-6,8,11-17H2,1-3H3,(H,20,21) |
| InChIKey | QIWIDPXVJSHDRW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|