C23H35N7O — CID 111274509
3-ethyl-1-methyl-1-(2-phenoxyethyl)-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111274509) has the molecular formula C23H35N7O and a molecular weight of 425.58 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(2-phenoxyethyl)-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-(2-phenoxyethyl)-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111274509 |
| Molecular Formula | C23H35N7O |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | 3-ethyl-1-methyl-1-(2-phenoxyethyl)-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CCCN1CCN(c2ncccn2)CC1)N(C)CCOc1ccccc1 |
| InChI | InChI=1S/C23H35N7O/c1-3-24-22(28(2)19-20-31-21-9-5-4-6-10-21)25-13-8-14-29-15-17-30(18-16-29)23-26-11-7-12-27-23/h4-7,9-12H,3,8,13-20H2,1-2H3,(H,24,25) |
| InChIKey | CDPMGJPEWPWIJK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|