C22H33FIN7 — CID 111308017
3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111308017) has the molecular formula C22H33FIN7 and a molecular weight of 541.46 g/mol. Its IUPAC name is 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111308017 |
| Molecular Formula | C22H33FIN7 |
| Molecular Weight | 541.46 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | 3-ethyl-1-[(4-fluorophenyl)methyl]-1-methyl-2-[3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCN1CCN(c2ncccn2)CC1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C22H32FN7.HI/c1-3-24-21(28(2)18-19-6-8-20(23)9-7-19)25-12-5-13-29-14-16-30(17-15-29)22-26-10-4-11-27-22;/h4,6-11H,3,5,12-18H2,1-2H3,(H,24,25);1H |
| InChIKey | JJVBLNOHKRCFCC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.46 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|