C21H31ClIN7 — CID 111294138
1-[(4-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111294138) has the molecular formula C21H31ClIN7 and a molecular weight of 543.89 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111294138 |
| Molecular Formula | C21H31ClIN7 |
| Molecular Weight | 543.89 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-ethyl-1-methyl-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCN(c2ncccn2)CC1)N(C)Cc1ccc(Cl)cc1.I |
| InChI | InChI=1S/C21H30ClN7.HI/c1-3-23-20(27(2)17-18-5-7-19(22)8-6-18)26-11-12-28-13-15-29(16-14-28)21-24-9-4-10-25-21;/h4-10H,3,11-17H2,1-2H3,(H,23,26);1H |
| InChIKey | MSTLRWOHVBXEGD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.89 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|