C20H25N5O3S — CID 19023463
5-methyl-1,1-dioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-3-one (PubChem CID 19023463) has the molecular formula C20H25N5O3S and a molecular weight of 415.52 g/mol. Its IUPAC name is 5-methyl-1,1-dioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-3-one.
| Compound Name | 5-methyl-1,1-dioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 19023463 |
| Molecular Formula | C20H25N5O3S |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 5-methyl-1,1-dioxo-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,2-benzothiazol-3-one |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCCN1CCN(c3ncccn3)CC1)S2(=O)=O |
| InChI | InChI=1S/C20H25N5O3S/c1-16-5-6-18-17(15-16)19(26)25(29(18,27)28)10-3-2-9-23-11-13-24(14-12-23)20-21-7-4-8-22-20/h4-8,15H,2-3,9-14H2,1H3 |
| InChIKey | KPJZTFDRWHPYNN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|