C24H31N5O2 — CID 18327958
3,7-dimethyl-4-[5-(4-pyrimidin-2-ylpiperazin-1-yl)pentyl]-1,4-benzoxazepin-5-one (PubChem CID 18327958) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 3,7-dimethyl-4-[5-(4-pyrimidin-2-ylpiperazin-1-yl)pentyl]-1,4-benzoxazepin-5-one.
| Compound Name | 3,7-dimethyl-4-[5-(4-pyrimidin-2-ylpiperazin-1-yl)pentyl]-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 18327958 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 3,7-dimethyl-4-[5-(4-pyrimidin-2-ylpiperazin-1-yl)pentyl]-1,4-benzoxazepin-5-one |
| SMILES | CC1=COc2ccc(C)cc2C(=O)N1CCCCCN1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C24H31N5O2/c1-19-7-8-22-21(17-19)23(30)29(20(2)18-31-22)12-5-3-4-11-27-13-15-28(16-14-27)24-25-9-6-10-26-24/h6-10,17-18H,3-5,11-16H2,1-2H3 |
| InChIKey | NYIUTCHKWKQIBF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|