C25H31N3O2 — CID 18328024
3,8-dimethyl-4-[4-(4-phenylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one (PubChem CID 18328024) has the molecular formula C25H31N3O2 and a molecular weight of 405.54 g/mol. Its IUPAC name is 3,8-dimethyl-4-[4-(4-phenylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one.
| Compound Name | 3,8-dimethyl-4-[4-(4-phenylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 18328024 |
| Molecular Formula | C25H31N3O2 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 3,8-dimethyl-4-[4-(4-phenylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one |
| SMILES | CC1=COc2cc(C)ccc2C(=O)N1CCCCN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H31N3O2/c1-20-10-11-23-24(18-20)30-19-21(2)28(25(23)29)13-7-6-12-26-14-16-27(17-15-26)22-8-4-3-5-9-22/h3-5,8-11,18-19H,6-7,12-17H2,1-2H3 |
| InChIKey | PLHKOIPMIRKNPM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|