C32H38N6O2 — CID 10098747
6-methyl-4-(4-phenylpiperazin-1-yl)-2-[4-(4-phenylpiperazin-1-yl)butyl]pyrrolo[3,4-c]pyridine-1,3-dione (PubChem CID 10098747) has the molecular formula C32H38N6O2 and a molecular weight of 538.70 g/mol. Its IUPAC name is 6-methyl-4-(4-phenylpiperazin-1-yl)-2-[4-(4-phenylpiperazin-1-yl)butyl]pyrrolo[3,4-c]pyridine-1,3-dione.
| Compound Name | 6-methyl-4-(4-phenylpiperazin-1-yl)-2-[4-(4-phenylpiperazin-1-yl)butyl]pyrrolo[3,4-c]pyridine-1,3-dione |
|---|---|
| PubChem CID | 10098747 |
| Molecular Formula | C32H38N6O2 |
| Molecular Weight | 538.70 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 6-methyl-4-(4-phenylpiperazin-1-yl)-2-[4-(4-phenylpiperazin-1-yl)butyl]pyrrolo[3,4-c]pyridine-1,3-dione |
| SMILES | Cc1cc2c(c(N3CCN(c4ccccc4)CC3)n1)C(=O)N(CCCCN1CCN(c3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C32H38N6O2/c1-25-24-28-29(30(33-25)37-22-20-36(21-23-37)27-12-6-3-7-13-27)32(40)38(31(28)39)15-9-8-14-34-16-18-35(19-17-34)26-10-4-2-5-11-26/h2-7,10-13,24H,8-9,14-23H2,1H3 |
| InChIKey | IVQXMEPWTUGUTP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|