C25H29N7O2 — CID 10718752
4,6-dimethyl-5-pyridin-3-yl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrrolo[3,4-c]pyrrole-1,3-dione (PubChem CID 10718752) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4,6-dimethyl-5-pyridin-3-yl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrrolo[3,4-c]pyrrole-1,3-dione.
| Compound Name | 4,6-dimethyl-5-pyridin-3-yl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrrolo[3,4-c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 10718752 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 4,6-dimethyl-5-pyridin-3-yl-2-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]pyrrolo[3,4-c]pyrrole-1,3-dione |
| SMILES | Cc1c2c(c(C)n1-c1cccnc1)C(=O)N(CCCCN1CCN(c3ncccn3)CC1)C2=O |
| InChI | InChI=1S/C25H29N7O2/c1-18-21-22(19(2)32(18)20-7-5-8-26-17-20)24(34)31(23(21)33)12-4-3-11-29-13-15-30(16-14-29)25-27-9-6-10-28-25/h5-10,17H,3-4,11-16H2,1-2H3 |
| InChIKey | WESWQBCLESLGKQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|