C24H29ClN4O4 — CID 67833361
acetic acid;2-[4-[4-(3-amino-4-chlorophenyl)piperazin-1-yl]butyl]isoindole-1,3-dione (PubChem CID 67833361) has the molecular formula C24H29ClN4O4 and a molecular weight of 472.97 g/mol. Its IUPAC name is acetic acid;2-[4-[4-(3-amino-4-chlorophenyl)piperazin-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | acetic acid;2-[4-[4-(3-amino-4-chlorophenyl)piperazin-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67833361 |
| Molecular Formula | C24H29ClN4O4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | acetic acid;2-[4-[4-(3-amino-4-chlorophenyl)piperazin-1-yl]butyl]isoindole-1,3-dione |
| SMILES | CC(=O)O.Nc1cc(N2CCN(CCCCN3C(=O)c4ccccc4C3=O)CC2)ccc1Cl |
| InChI | InChI=1S/C22H25ClN4O2.C2H4O2/c23-19-8-7-16(15-20(19)24)26-13-11-25(12-14-26)9-3-4-10-27-21(28)17-5-1-2-6-18(17)22(27)29;1-2(3)4/h1-2,5-8,15H,3-4,9-14,24H2;1H3,(H,3,4) |
| InChIKey | VBJWHUUCLITGEV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 107.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|