C26H40N6O4 — CID 162054424
2-[3-(4-acetylpiperazin-1-yl)propyl]isoindole-1,3-dione;1-[4-(3-aminopropyl)piperazin-1-yl]ethanone (PubChem CID 162054424) has the molecular formula C26H40N6O4 and a molecular weight of 500.64 g/mol. Its IUPAC name is 2-[3-(4-acetylpiperazin-1-yl)propyl]isoindole-1,3-dione;1-[4-(3-aminopropyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[3-(4-acetylpiperazin-1-yl)propyl]isoindole-1,3-dione;1-[4-(3-aminopropyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 162054424 |
| Molecular Formula | C26H40N6O4 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | 2-[3-(4-acetylpiperazin-1-yl)propyl]isoindole-1,3-dione;1-[4-(3-aminopropyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CCCN)CC1.CC(=O)N1CCN(CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C17H21N3O3.C9H19N3O/c1-13(21)19-11-9-18(10-12-19)7-4-8-20-16(22)14-5-2-3-6-15(14)17(20)23;1-9(13)12-7-5-11(6-8-12)4-2-3-10/h2-3,5-6H,4,7-12H2,1H3;2-8,10H2,1H3 |
| InChIKey | YYZHNPXVNLJGOY-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 110.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|