C18H24N4O3 — CID 86912387
4-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-ethylpiperazine-1-carboxamide (PubChem CID 86912387) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-ethylpiperazine-1-carboxamide.
| Compound Name | 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-ethylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 86912387 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 4-[3-(1,3-dioxoisoindol-2-yl)propyl]-N-ethylpiperazine-1-carboxamide |
| SMILES | CCNC(=O)N1CCN(CCCN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C18H24N4O3/c1-2-19-18(25)21-12-10-20(11-13-21)8-5-9-22-16(23)14-6-3-4-7-15(14)17(22)24/h3-4,6-7H,2,5,8-13H2,1H3,(H,19,25) |
| InChIKey | ZOKVMNDTAPTFPH-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|