C19H27N3O3 — CID 86293406
5,5-dimethyl-3-[4-(4-phenylpiperazin-1-yl)butyl]-1,3-oxazolidine-2,4-dione (PubChem CID 86293406) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 5,5-dimethyl-3-[4-(4-phenylpiperazin-1-yl)butyl]-1,3-oxazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-3-[4-(4-phenylpiperazin-1-yl)butyl]-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 86293406 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 5,5-dimethyl-3-[4-(4-phenylpiperazin-1-yl)butyl]-1,3-oxazolidine-2,4-dione |
| SMILES | CC1(C)OC(=O)N(CCCCN2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C19H27N3O3/c1-19(2)17(23)22(18(24)25-19)11-7-6-10-20-12-14-21(15-13-20)16-8-4-3-5-9-16/h3-5,8-9H,6-7,10-15H2,1-2H3 |
| InChIKey | YFTUOUJCXKJXDC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|