C22H34N2O2 — CID 162368702
3,3-diethyl-5-[4-(4-phenylpiperazin-1-yl)butyl]oxolan-2-one (PubChem CID 162368702) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is 3,3-diethyl-5-[4-(4-phenylpiperazin-1-yl)butyl]oxolan-2-one.
| Compound Name | 3,3-diethyl-5-[4-(4-phenylpiperazin-1-yl)butyl]oxolan-2-one |
|---|---|
| PubChem CID | 162368702 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | 3,3-diethyl-5-[4-(4-phenylpiperazin-1-yl)butyl]oxolan-2-one |
| SMILES | CCC1(CC)CC(CCCCN2CCN(c3ccccc3)CC2)OC1=O |
| InChI | InChI=1S/C22H34N2O2/c1-3-22(4-2)18-20(26-21(22)25)12-8-9-13-23-14-16-24(17-15-23)19-10-6-5-7-11-19/h5-7,10-11,20H,3-4,8-9,12-18H2,1-2H3 |
| InChIKey | CUHIXMQILVDCPK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|