C19H29N3O2 — CID 140837611
(5S)-3,3-diethyl-5-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]oxolan-2-one (PubChem CID 140837611) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is (5S)-3,3-diethyl-5-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]oxolan-2-one.
| Compound Name | (5S)-3,3-diethyl-5-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]oxolan-2-one |
|---|---|
| PubChem CID | 140837611 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | (5S)-3,3-diethyl-5-[2-(4-pyridin-2-ylpiperazin-1-yl)ethyl]oxolan-2-one |
| SMILES | CCC1(CC)C[C@@H](CCN2CCN(c3ccccn3)CC2)OC1=O |
| InChI | InChI=1S/C19H29N3O2/c1-3-19(4-2)15-16(24-18(19)23)8-10-21-11-13-22(14-12-21)17-7-5-6-9-20-17/h5-7,9,16H,3-4,8,10-15H2,1-2H3/t16-/m1/s1 |
| InChIKey | BIAVCHCXYRKJMN-MRXNPFEDSA-N |
| XLogP | 2.72 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |