C22H28N4O2 — CID 19811488
3-phenyl-5-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-oxazolidin-2-one (PubChem CID 19811488) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 3-phenyl-5-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-phenyl-5-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 19811488 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 3-phenyl-5-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(CCCCN2CCN(c3ccccn3)CC2)CN1c1ccccc1 |
| InChI | InChI=1S/C22H28N4O2/c27-22-26(19-8-2-1-3-9-19)18-20(28-22)10-5-7-13-24-14-16-25(17-15-24)21-11-4-6-12-23-21/h1-4,6,8-9,11-12,20H,5,7,10,13-18H2 |
| InChIKey | BYJMZJACNFRDDG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|