C22H26N4O4 — CID 10251011
2-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-5,6-dimethylpyrrolo[3,4-c]pyridine-1,3,4-trione (PubChem CID 10251011) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-5,6-dimethylpyrrolo[3,4-c]pyridine-1,3,4-trione.
| Compound Name | 2-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-5,6-dimethylpyrrolo[3,4-c]pyridine-1,3,4-trione |
|---|---|
| PubChem CID | 10251011 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 2-[2-hydroxy-3-(4-phenylpiperazin-1-yl)propyl]-5,6-dimethylpyrrolo[3,4-c]pyridine-1,3,4-trione |
| SMILES | Cc1cc2c(c(=O)n1C)C(=O)N(CC(O)CN1CCN(c3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C22H26N4O4/c1-15-12-18-19(21(29)23(15)2)22(30)26(20(18)28)14-17(27)13-24-8-10-25(11-9-24)16-6-4-3-5-7-16/h3-7,12,17,27H,8-11,13-14H2,1-2H3 |
| InChIKey | MYIKNTSUZNPEPB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|