C19H28N4O4 — CID 95389250
3-[(2S)-2-hydroxy-3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 95389250) has the molecular formula C19H28N4O4 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[(2S)-2-hydroxy-3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 3-[(2S)-2-hydroxy-3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95389250 |
| Molecular Formula | C19H28N4O4 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-[(2S)-2-hydroxy-3-[4-(3-methoxyphenyl)piperazin-1-yl]propyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | COc1cccc(N2CCN(C[C@H](O)CN3C(=O)NC(C)(C)C3=O)CC2)c1 |
| InChI | InChI=1S/C19H28N4O4/c1-19(2)17(25)23(18(26)20-19)13-15(24)12-21-7-9-22(10-8-21)14-5-4-6-16(11-14)27-3/h4-6,11,15,24H,7-10,12-13H2,1-3H3,(H,20,26)/t15-/m0/s1 |
| InChIKey | ZFGPUGOQZJEOII-HNNXBMFYSA-N |
| XLogP | 0.51 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|