C25H32N4O3 — CID 18327929
3-(methoxymethyl)-7-methyl-4-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one (PubChem CID 18327929) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 3-(methoxymethyl)-7-methyl-4-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one.
| Compound Name | 3-(methoxymethyl)-7-methyl-4-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 18327929 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 3-(methoxymethyl)-7-methyl-4-[4-(4-pyridin-2-ylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one |
| SMILES | COCC1=COc2ccc(C)cc2C(=O)N1CCCCN1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C25H32N4O3/c1-20-8-9-23-22(17-20)25(30)29(21(18-31-2)19-32-23)12-6-5-11-27-13-15-28(16-14-27)24-7-3-4-10-26-24/h3-4,7-10,17,19H,5-6,11-16,18H2,1-2H3 |
| InChIKey | VWAHRJSJMCWSDG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|