C23H28ClN5O3 — CID 18328008
3-(chloromethyl)-7-methoxy-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one (PubChem CID 18328008) has the molecular formula C23H28ClN5O3 and a molecular weight of 457.96 g/mol. Its IUPAC name is 3-(chloromethyl)-7-methoxy-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one.
| Compound Name | 3-(chloromethyl)-7-methoxy-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 18328008 |
| Molecular Formula | C23H28ClN5O3 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 3-(chloromethyl)-7-methoxy-4-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-1,4-benzoxazepin-5-one |
| SMILES | COc1ccc2c(c1)C(=O)N(CCCCN1CCN(c3ncccn3)CC1)C(CCl)=CO2 |
| InChI | InChI=1S/C23H28ClN5O3/c1-31-19-5-6-21-20(15-19)22(30)29(18(16-24)17-32-21)10-3-2-9-27-11-13-28(14-12-27)23-25-7-4-8-26-23/h4-8,15,17H,2-3,9-14,16H2,1H3 |
| InChIKey | PGSNBYNCFYSCJR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|