C23H29ClN4O3 — CID 57174263
3-(chloromethyl)-4-[4-[3-(1H-imidazol-5-yl)piperidin-1-yl]butyl]-7-methoxy-1,4-benzoxazepin-5-one (PubChem CID 57174263) has the molecular formula C23H29ClN4O3 and a molecular weight of 444.96 g/mol. Its IUPAC name is 3-(chloromethyl)-4-[4-[3-(1H-imidazol-5-yl)piperidin-1-yl]butyl]-7-methoxy-1,4-benzoxazepin-5-one.
| Compound Name | 3-(chloromethyl)-4-[4-[3-(1H-imidazol-5-yl)piperidin-1-yl]butyl]-7-methoxy-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 57174263 |
| Molecular Formula | C23H29ClN4O3 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 3-(chloromethyl)-4-[4-[3-(1H-imidazol-5-yl)piperidin-1-yl]butyl]-7-methoxy-1,4-benzoxazepin-5-one |
| SMILES | COc1ccc2c(c1)C(=O)N(CCCCN1CCCC(c3cnc[nH]3)C1)C(CCl)=CO2 |
| InChI | InChI=1S/C23H29ClN4O3/c1-30-19-6-7-22-20(11-19)23(29)28(18(12-24)15-31-22)10-3-2-8-27-9-4-5-17(14-27)21-13-25-16-26-21/h6-7,11,13,15-17H,2-5,8-10,12,14H2,1H3,(H,25,26) |
| InChIKey | HZICAFJCCZVMER-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|