C23H27ClN4O3 — CID 18327972
3-chloro-7-methoxy-4-[4-(3-pyrimidin-2-ylpiperidin-1-yl)butyl]-1,4-benzoxazepin-5-one (PubChem CID 18327972) has the molecular formula C23H27ClN4O3 and a molecular weight of 442.95 g/mol. Its IUPAC name is 3-chloro-7-methoxy-4-[4-(3-pyrimidin-2-ylpiperidin-1-yl)butyl]-1,4-benzoxazepin-5-one.
| Compound Name | 3-chloro-7-methoxy-4-[4-(3-pyrimidin-2-ylpiperidin-1-yl)butyl]-1,4-benzoxazepin-5-one |
|---|---|
| PubChem CID | 18327972 |
| Molecular Formula | C23H27ClN4O3 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 3-chloro-7-methoxy-4-[4-(3-pyrimidin-2-ylpiperidin-1-yl)butyl]-1,4-benzoxazepin-5-one |
| SMILES | COc1ccc2c(c1)C(=O)N(CCCCN1CCCC(c3ncccn3)C1)C(Cl)=CO2 |
| InChI | InChI=1S/C23H27ClN4O3/c1-30-18-7-8-20-19(14-18)23(29)28(21(24)16-31-20)13-3-2-11-27-12-4-6-17(15-27)22-25-9-5-10-26-22/h5,7-10,14,16-17H,2-4,6,11-13,15H2,1H3 |
| InChIKey | USOUPQZPBWCPKH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|