C21H27NO — CID 54564163
(3S)-3-(3-methoxyphenyl)-1-(3-phenylpropyl)piperidine (PubChem CID 54564163) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (3S)-3-(3-methoxyphenyl)-1-(3-phenylpropyl)piperidine.
| Compound Name | (3S)-3-(3-methoxyphenyl)-1-(3-phenylpropyl)piperidine |
|---|---|
| PubChem CID | 54564163 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (3S)-3-(3-methoxyphenyl)-1-(3-phenylpropyl)piperidine |
| SMILES | COc1cccc([C@@H]2CCCN(CCCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H27NO/c1-23-21-13-5-11-19(16-21)20-12-7-15-22(17-20)14-6-10-18-8-3-2-4-9-18/h2-5,8-9,11,13,16,20H,6-7,10,12,14-15,17H2,1H3/t20-/m1/s1 |
| InChIKey | ZSQODCGBWPKYAR-HXUWFJFHSA-N |
| XLogP | 4.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |