C22H27F3N2O — CID 24994617
(2R)-4-[3-(3-methoxyphenyl)piperidin-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine (PubChem CID 24994617) has the molecular formula C22H27F3N2O and a molecular weight of 392.47 g/mol. Its IUPAC name is (2R)-4-[3-(3-methoxyphenyl)piperidin-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine.
| Compound Name | (2R)-4-[3-(3-methoxyphenyl)piperidin-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 24994617 |
| Molecular Formula | C22H27F3N2O |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (2R)-4-[3-(3-methoxyphenyl)piperidin-1-yl]-1-(2,4,5-trifluorophenyl)butan-2-amine |
| SMILES | COc1cccc(C2CCCN(CC[C@H](N)Cc3cc(F)c(F)cc3F)C2)c1 |
| InChI | InChI=1S/C22H27F3N2O/c1-28-19-6-2-4-15(11-19)16-5-3-8-27(14-16)9-7-18(26)10-17-12-21(24)22(25)13-20(17)23/h2,4,6,11-13,16,18H,3,5,7-10,14,26H2,1H3/t16?,18-/m0/s1 |
| InChIKey | FKLDTBYHDCDWBD-DAFXYXGESA-N |
| XLogP | 4.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|