C19H29NO2 — CID 23045628
[3-(1-propylpiperidin-3-yl)phenyl] 2,2-dimethylpropanoate (PubChem CID 23045628) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is [3-(1-propylpiperidin-3-yl)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [3-(1-propylpiperidin-3-yl)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 23045628 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | [3-(1-propylpiperidin-3-yl)phenyl] 2,2-dimethylpropanoate |
| SMILES | CCCN1CCCC(c2cccc(OC(=O)C(C)(C)C)c2)C1 |
| InChI | InChI=1S/C19H29NO2/c1-5-11-20-12-7-9-16(14-20)15-8-6-10-17(13-15)22-18(21)19(2,3)4/h6,8,10,13,16H,5,7,9,11-12,14H2,1-4H3 |
| InChIKey | PYUADUBOQPIBNE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|