C25H41NO3 — CID 123657572
4-[3-(3-decan-2-yloxyphenyl)piperidin-1-yl]butanoic acid (PubChem CID 123657572) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is 4-[3-(3-decan-2-yloxyphenyl)piperidin-1-yl]butanoic acid.
| Compound Name | 4-[3-(3-decan-2-yloxyphenyl)piperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 123657572 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 4-[3-(3-decan-2-yloxyphenyl)piperidin-1-yl]butanoic acid |
| SMILES | CCCCCCCCC(C)Oc1cccc(C2CCCN(CCCC(=O)O)C2)c1 |
| InChI | InChI=1S/C25H41NO3/c1-3-4-5-6-7-8-12-21(2)29-24-15-9-13-22(19-24)23-14-10-17-26(20-23)18-11-16-25(27)28/h9,13,15,19,21,23H,3-8,10-12,14,16-18,20H2,1-2H3,(H,27,28) |
| InChIKey | ZHSVEOPQWSSUNC-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|