C52H83BrN2O6 — CID 161471208
3-[3-(4-tert-butylcyclohexyl)oxyphenyl]piperidine;4-[3-[3-(4-tert-butylcyclohexyl)oxyphenyl]piperidin-1-yl]butanoic acid;ethyl 4-bromobutanoate (PubChem CID 161471208) has the molecular formula C52H83BrN2O6 and a molecular weight of 912.15 g/mol. Its IUPAC name is 3-[3-(4-tert-butylcyclohexyl)oxyphenyl]piperidine;4-[3-[3-(4-tert-butylcyclohexyl)oxyphenyl]piperidin-1-yl]butanoic acid;ethyl 4-bromobutanoate.
| Compound Name | 3-[3-(4-tert-butylcyclohexyl)oxyphenyl]piperidine;4-[3-[3-(4-tert-butylcyclohexyl)oxyphenyl]piperidin-1-yl]butanoic acid;ethyl 4-bromobutanoate |
|---|---|
| PubChem CID | 161471208 |
| Molecular Formula | C52H83BrN2O6 |
| Molecular Weight | 912.15 g/mol |
| Exact Mass | 910.54 |
| IUPAC Name | 3-[3-(4-tert-butylcyclohexyl)oxyphenyl]piperidine;4-[3-[3-(4-tert-butylcyclohexyl)oxyphenyl]piperidin-1-yl]butanoic acid;ethyl 4-bromobutanoate |
| SMILES | CC(C)(C)C1CCC(Oc2cccc(C3CCCN(CCCC(=O)O)C3)c2)CC1.CC(C)(C)C1CCC(Oc2cccc(C3CCCNC3)c2)CC1.CCOC(=O)CCCBr |
| InChI | InChI=1S/C25H39NO3.C21H33NO.C6H11BrO2/c1-25(2,3)21-11-13-22(14-12-21)29-23-9-4-7-19(17-23)20-8-5-15-26(18-20)16-6-10-24(27)28;1-21(2,3)18-9-11-19(12-10-18)23-20-8-4-6-16(14-20)17-7-5-13-22-15-17;1-2-9-6(8)4-3-5-7/h4,7,9,17,20-22H,5-6,8,10-16,18H2,1-3H3,(H,27,28);4,6,8,14,17-19,22H,5,7,9-13,15H2,1-3H3;2-5H2,1H3 |
| InChIKey | WDCKQZDDWDXQAE-UHFFFAOYSA-N |
| XLogP | 12.58 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 912.15 |
| LogP ≤ 5 | 12.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|