C26H36O3 — CID 157482882
ethyl 4-[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]butanoate (PubChem CID 157482882) has the molecular formula C26H36O3 and a molecular weight of 396.57 g/mol. Its IUPAC name is ethyl 4-[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]butanoate.
| Compound Name | ethyl 4-[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]butanoate |
|---|---|
| PubChem CID | 157482882 |
| Molecular Formula | C26H36O3 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | ethyl 4-[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc2cc(OC3CCC(C(C)(C)C)CC3)ccc2c1 |
| InChI | InChI=1S/C26H36O3/c1-5-28-25(27)8-6-7-19-9-10-21-18-24(14-11-20(21)17-19)29-23-15-12-22(13-16-23)26(2,3)4/h9-11,14,17-18,22-23H,5-8,12-13,15-16H2,1-4H3 |
| InChIKey | HPPKQNUHNOUOSE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |