C27H42NO4P — CID 86668415
N-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl]-2-diethoxyphosphorylethanamine (PubChem CID 86668415) has the molecular formula C27H42NO4P and a molecular weight of 475.61 g/mol. Its IUPAC name is N-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl]-2-diethoxyphosphorylethanamine.
| Compound Name | N-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl]-2-diethoxyphosphorylethanamine |
|---|---|
| PubChem CID | 86668415 |
| Molecular Formula | C27H42NO4P |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | N-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methyl]-2-diethoxyphosphorylethanamine |
| SMILES | CCOP(=O)(CCNCc1ccc2cc(OC3CCC(C(C)(C)C)CC3)ccc2c1)OCC |
| InChI | InChI=1S/C27H42NO4P/c1-6-30-33(29,31-7-2)17-16-28-20-21-8-9-23-19-26(13-10-22(23)18-21)32-25-14-11-24(12-15-25)27(3,4)5/h8-10,13,18-19,24-25,28H,6-7,11-12,14-17,20H2,1-5H3 |
| InChIKey | ZWDVZSKLETZMRQ-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|