C23H30N2O — CID 86668419
2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methylamino]acetonitrile (PubChem CID 86668419) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is 2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methylamino]acetonitrile.
| Compound Name | 2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methylamino]acetonitrile |
|---|---|
| PubChem CID | 86668419 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methylamino]acetonitrile |
| SMILES | CC(C)(C)C1CCC(Oc2ccc3cc(CNCC#N)ccc3c2)CC1 |
| InChI | InChI=1S/C23H30N2O/c1-23(2,3)20-7-10-21(11-8-20)26-22-9-6-18-14-17(16-25-13-12-24)4-5-19(18)15-22/h4-6,9,14-15,20-21,25H,7-8,10-11,13,16H2,1-3H3 |
| InChIKey | GUWFDMQSNAOXEV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|