C23H34NO4P — CID 51002113
2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methylamino]ethylphosphonic acid (PubChem CID 51002113) has the molecular formula C23H34NO4P and a molecular weight of 419.50 g/mol. Its IUPAC name is 2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methylamino]ethylphosphonic acid.
| Compound Name | 2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methylamino]ethylphosphonic acid |
|---|---|
| PubChem CID | 51002113 |
| Molecular Formula | C23H34NO4P |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]methylamino]ethylphosphonic acid |
| SMILES | CC(C)(C)C1CCC(Oc2ccc3cc(CNCCP(=O)(O)O)ccc3c2)CC1 |
| InChI | InChI=1S/C23H34NO4P/c1-23(2,3)20-7-10-21(11-8-20)28-22-9-6-18-14-17(4-5-19(18)15-22)16-24-12-13-29(25,26)27/h4-6,9,14-15,20-21,24H,7-8,10-13,16H2,1-3H3,(H2,25,26,27) |
| InChIKey | SZIIHVINOJAPFI-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|