C26H37NO3 — CID 70496663
3-[2-[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]propan-2-ylamino]propanoic acid (PubChem CID 70496663) has the molecular formula C26H37NO3 and a molecular weight of 411.59 g/mol. Its IUPAC name is 3-[2-[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]propan-2-ylamino]propanoic acid.
| Compound Name | 3-[2-[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]propan-2-ylamino]propanoic acid |
|---|---|
| PubChem CID | 70496663 |
| Molecular Formula | C26H37NO3 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.28 |
| IUPAC Name | 3-[2-[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]propan-2-ylamino]propanoic acid |
| SMILES | CC(C)(NCCC(=O)O)c1ccc2cc(OC3CCC(C(C)(C)C)CC3)ccc2c1 |
| InChI | InChI=1S/C26H37NO3/c1-25(2,3)20-9-12-22(13-10-20)30-23-11-7-18-16-21(8-6-19(18)17-23)26(4,5)27-15-14-24(28)29/h6-8,11,16-17,20,22,27H,9-10,12-15H2,1-5H3,(H,28,29) |
| InChIKey | DOKBPVRSRHAFFS-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |