C24H33NO3 — CID 51002209
2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]-methylamino]propanoic acid (PubChem CID 51002209) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is 2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]-methylamino]propanoic acid.
| Compound Name | 2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 51002209 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | 2-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-2-yl]-methylamino]propanoic acid |
| SMILES | CC(C(=O)O)N(C)c1ccc2cc(OC3CCC(C(C)(C)C)CC3)ccc2c1 |
| InChI | InChI=1S/C24H33NO3/c1-16(23(26)27)25(5)20-10-6-18-15-22(11-7-17(18)14-20)28-21-12-8-19(9-13-21)24(2,3)4/h6-7,10-11,14-16,19,21H,8-9,12-13H2,1-5H3,(H,26,27) |
| InChIKey | YMOKFICEKCMOCW-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |