C26H34FNO3 — CID 90176922
3-[3-[4-(4-tert-butylcyclohexyl)oxyphenyl]-5-fluoro-N-methylanilino]propanoic acid (PubChem CID 90176922) has the molecular formula C26H34FNO3 and a molecular weight of 427.56 g/mol. Its IUPAC name is 3-[3-[4-(4-tert-butylcyclohexyl)oxyphenyl]-5-fluoro-N-methylanilino]propanoic acid.
| Compound Name | 3-[3-[4-(4-tert-butylcyclohexyl)oxyphenyl]-5-fluoro-N-methylanilino]propanoic acid |
|---|---|
| PubChem CID | 90176922 |
| Molecular Formula | C26H34FNO3 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 3-[3-[4-(4-tert-butylcyclohexyl)oxyphenyl]-5-fluoro-N-methylanilino]propanoic acid |
| SMILES | CN(CCC(=O)O)c1cc(F)cc(-c2ccc(OC3CCC(C(C)(C)C)CC3)cc2)c1 |
| InChI | InChI=1S/C26H34FNO3/c1-26(2,3)20-7-11-24(12-8-20)31-23-9-5-18(6-10-23)19-15-21(27)17-22(16-19)28(4)14-13-25(29)30/h5-6,9-10,15-17,20,24H,7-8,11-14H2,1-4H3,(H,29,30) |
| InChIKey | ONXBGFLLPXNTAU-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |