C26H36N2O4 — CID 122471506
[1-[[6-(4-tert-butylcyclohexyl)oxyquinolin-2-yl]methyl]piperidin-4-yl] hydrogen carbonate (PubChem CID 122471506) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is [1-[[6-(4-tert-butylcyclohexyl)oxyquinolin-2-yl]methyl]piperidin-4-yl] hydrogen carbonate.
| Compound Name | [1-[[6-(4-tert-butylcyclohexyl)oxyquinolin-2-yl]methyl]piperidin-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 122471506 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | [1-[[6-(4-tert-butylcyclohexyl)oxyquinolin-2-yl]methyl]piperidin-4-yl] hydrogen carbonate |
| SMILES | CC(C)(C)C1CCC(Oc2ccc3nc(CN4CCC(OC(=O)O)CC4)ccc3c2)CC1 |
| InChI | InChI=1S/C26H36N2O4/c1-26(2,3)19-5-8-21(9-6-19)31-23-10-11-24-18(16-23)4-7-20(27-24)17-28-14-12-22(13-15-28)32-25(29)30/h4,7,10-11,16,19,21-22H,5-6,8-9,12-15,17H2,1-3H3,(H,29,30) |
| InChIKey | YQQUBMNXHCIIFP-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |