C27H37NO3 — CID 73292615
1-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-1-yl]methyl]piperidine-4-carboxylic acid (PubChem CID 73292615) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is 1-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-1-yl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-1-yl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 73292615 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | 1-[[6-(4-tert-butylcyclohexyl)oxynaphthalen-1-yl]methyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)(C)C1CCC(Oc2ccc3c(CN4CCC(C(=O)O)CC4)cccc3c2)CC1 |
| InChI | InChI=1S/C27H37NO3/c1-27(2,3)22-7-9-23(10-8-22)31-24-11-12-25-20(17-24)5-4-6-21(25)18-28-15-13-19(14-16-28)26(29)30/h4-6,11-12,17,19,22-23H,7-10,13-16,18H2,1-3H3,(H,29,30) |
| InChIKey | QYDOGRLVVGUHJP-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |