C25H32FNO3 — CID 90182778
2-[[3-[4-(4-tert-butylcyclohexyl)oxyphenyl]-2-fluorophenyl]methylamino]acetic acid (PubChem CID 90182778) has the molecular formula C25H32FNO3 and a molecular weight of 413.53 g/mol. Its IUPAC name is 2-[[3-[4-(4-tert-butylcyclohexyl)oxyphenyl]-2-fluorophenyl]methylamino]acetic acid.
| Compound Name | 2-[[3-[4-(4-tert-butylcyclohexyl)oxyphenyl]-2-fluorophenyl]methylamino]acetic acid |
|---|---|
| PubChem CID | 90182778 |
| Molecular Formula | C25H32FNO3 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 2-[[3-[4-(4-tert-butylcyclohexyl)oxyphenyl]-2-fluorophenyl]methylamino]acetic acid |
| SMILES | CC(C)(C)C1CCC(Oc2ccc(-c3cccc(CNCC(=O)O)c3F)cc2)CC1 |
| InChI | InChI=1S/C25H32FNO3/c1-25(2,3)19-9-13-21(14-10-19)30-20-11-7-17(8-12-20)22-6-4-5-18(24(22)26)15-27-16-23(28)29/h4-8,11-12,19,21,27H,9-10,13-16H2,1-3H3,(H,28,29) |
| InChIKey | CMBIISBERVFLAG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |