C27H30FN3O2 — CID 24732865
4-[4-[2-[(dimethylamino)methyl]phenyl]phenoxy]-N-(3-fluorophenyl)piperidine-1-carboxamide (PubChem CID 24732865) has the molecular formula C27H30FN3O2 and a molecular weight of 447.55 g/mol. Its IUPAC name is 4-[4-[2-[(dimethylamino)methyl]phenyl]phenoxy]-N-(3-fluorophenyl)piperidine-1-carboxamide.
| Compound Name | 4-[4-[2-[(dimethylamino)methyl]phenyl]phenoxy]-N-(3-fluorophenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 24732865 |
| Molecular Formula | C27H30FN3O2 |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 4-[4-[2-[(dimethylamino)methyl]phenyl]phenoxy]-N-(3-fluorophenyl)piperidine-1-carboxamide |
| SMILES | CN(C)Cc1ccccc1-c1ccc(OC2CCN(C(=O)Nc3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C27H30FN3O2/c1-30(2)19-21-6-3-4-9-26(21)20-10-12-24(13-11-20)33-25-14-16-31(17-15-25)27(32)29-23-8-5-7-22(28)18-23/h3-13,18,25H,14-17,19H2,1-2H3,(H,29,32) |
| InChIKey | OGHTZBWHVPCTFO-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |